
CAS 101564-56-1
:3-Hexanone, 6-(3,4-dihydrospiro[naphthalene-1(2H),4′-piperidin]-1′-yl)-4,4-diphenyl-, ethanedioate (1:1)
Description:
3-Hexanone, 6-(3,4-dihydrospiro[naphthalene-1(2H),4′-piperidin]-1′-yl)-4,4-diphenyl-, ethanedioate (1:1), identified by CAS number 101564-56-1, is a complex organic compound characterized by its unique structural features. It contains a hexanone moiety, which contributes to its ketone functional group, and a spiro compound that incorporates a naphthalene and piperidine structure, indicating potential biological activity. The presence of diphenyl groups suggests significant steric hindrance, which may influence its reactivity and solubility. The ethanedioate component indicates the presence of carboxylate functionalities, which can participate in various chemical reactions, including esterification and salt formation. This compound may exhibit interesting properties such as lipophilicity due to its hydrophobic regions, making it potentially useful in pharmaceutical applications or as a synthetic intermediate. Its specific characteristics, including melting point, boiling point, and solubility, would require empirical data for precise determination, but its structural complexity suggests a multifaceted behavior in chemical reactions and interactions.
Formula:C32H37NO·C2H2O4
InChI:InChI=1S/C32H37NO.C2H2O4/c1-2-30(34)32(27-14-5-3-6-15-27,28-16-7-4-8-17-28)22-25-33-23-20-31(21-24-33)19-11-13-26-12-9-10-18-29(26)31;3-1(4)2(5)6/h3-10,12,14-18H,2,11,13,19-25H2,1H3;(H,3,4)(H,5,6)
InChI key:InChIKey=DRZCBAHULALFNW-UHFFFAOYSA-N
SMILES:C(CCN1CCC2(CC1)C=3C(CCC2)=CC=CC3)(C(CC)=O)(C4=CC=CC=C4)C5=CC=CC=C5.C(C(O)=O)(O)=O
Synonyms:- NSC 665324
- Spiro[naphthalene-1(2H),4′-piperidine], 3-hexanone deriv.
- 3-Hexanone, 6-(3,4-dihydrospiro[naphthalene-1(2H),4′-piperidin]-1′-yl)-4,4-diphenyl-, ethanedioate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Hexanone, 6-(3,4-dihydrospiro[naphthalene-1(2H),4'-piperidin]-1'-yl)-4,4-diphenyl-, ethanedioate (1:1)
CAS:Formula:C34H39NO5Molecular weight:541.6772
