
CAS 101565-96-2
:N-(3-Pyridinylmethyl)adenosine
Description:
N-(3-Pyridinylmethyl)adenosine, with the CAS number 101565-96-2, is a chemical compound that belongs to the class of adenosine derivatives. It features a pyridinylmethyl group attached to the adenosine structure, which is a nucleoside composed of adenine and ribose. This modification can influence its biological activity, potentially enhancing its interaction with adenosine receptors. The compound is typically characterized by its molecular structure, which includes a purine base (adenine) linked to a ribose sugar, along with the pyridinylmethyl substituent. It may exhibit properties such as solubility in polar solvents and specific binding affinities to various biological targets, making it of interest in pharmacological research. Its potential applications could include roles in modulating neurotransmission, inflammation, or other physiological processes mediated by adenosine signaling. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C16H18N6O4
InChI:InChI=1S/C16H18N6O4/c23-6-10-12(24)13(25)16(26-10)22-8-21-11-14(19-7-20-15(11)22)18-5-9-2-1-3-17-4-9/h1-4,7-8,10,12-13,16,23-25H,5-6H2,(H,18,19,20)/t10-,12-,13-,16-/m1/s1
InChI key:InChIKey=OGGGQWLDZCHKIQ-XNIJJKJLSA-N
SMILES:O[C@H]1[C@H](N2C=3C(N=C2)=C(NCC=4C=CC=NC4)N=CN3)O[C@H](CO)[C@H]1O
Synonyms:- N-(3-Pyridylmethyl)adenosine
- N6-(3-Pyridylmethyl)adenosine
- Adenosine, N-3-pyridylmethyl-
- N-(3-Pyridinylmethyl)adenosine
- Adenosine, N-(3-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
