CAS 101567-38-8

1,5-Dimethyl 3-methylenepentanedioate

Description:

1,5-Dimethyl 3-methylenepentanedioate, with the CAS number 101567-38-8, is an organic compound characterized by its structure, which includes two methyl groups and a methylene bridge within a pentanedioate framework. This compound features two carboxylate functional groups, which contribute to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methylene group enhances its reactivity, making it a useful intermediate in various chemical reactions, including esterification and polymerization processes. Additionally, the compound may exhibit solubility in organic solvents, which is common for esters and diesters. Its properties, such as boiling point, melting point, and density, can vary based on the specific isomer and environmental conditions. Overall, 1,5-Dimethyl 3-methylenepentanedioate is of interest in the fields of synthetic organic chemistry and materials science due to its versatile chemical behavior.

Formula: C₈H₁₂O₄

InChI: InChI=1S/C8H12O4/c1-6(4-7(9)11-2)5-8(10)12-3/h1,4-5H2,2-3H3

InChI key: InChIKey=KLYCSEKGIVPKSK-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)(CC(OC)=O)=C

Synonyms:

• Glutaric acid, 3-methylene-, dimethyl ester
• Pentanedioic acid, 3-methylene-, 1,5-dimethyl ester
• Pentanedioic acid, 3-methylene-, dimethyl ester
• 1,5-Dimethyl 3-methylenepentanedioate

1,5-dimethyl 3-methylidenepentanedioate

CAS: 101567-38-8

Formula: C₈H₁₂O₄

Molecular weight: 172.1785

Ref: IN-DA0004TW