
CAS 101567-38-8
:1,5-Dimethyl 3-methylenepentanedioate
Description:
1,5-Dimethyl 3-methylenepentanedioate, with the CAS number 101567-38-8, is an organic compound characterized by its structure, which includes two methyl groups and a methylene bridge within a pentanedioate framework. This compound features two carboxylate functional groups, which contribute to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methylene group enhances its reactivity, making it a useful intermediate in various chemical reactions, including esterification and polymerization processes. Additionally, the compound may exhibit solubility in organic solvents, which is common for esters and diesters. Its properties, such as boiling point, melting point, and density, can vary based on the specific isomer and environmental conditions. Overall, 1,5-Dimethyl 3-methylenepentanedioate is of interest in the fields of synthetic organic chemistry and materials science due to its versatile chemical behavior.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-6(4-7(9)11-2)5-8(10)12-3/h1,4-5H2,2-3H3
InChI key:InChIKey=KLYCSEKGIVPKSK-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)(CC(OC)=O)=C
Synonyms:- Glutaric acid, 3-methylene-, dimethyl ester
- Pentanedioic acid, 3-methylene-, 1,5-dimethyl ester
- Pentanedioic acid, 3-methylene-, dimethyl ester
- 1,5-Dimethyl 3-methylenepentanedioate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
