CAS 101578-28-3
:N-[5-(4-aminophenoxy)pentyl]pyridine-3-carboxamide
Description:
N-[5-(4-aminophenoxy)pentyl]pyridine-3-carboxamide, with the CAS number 101578-28-3, is a chemical compound characterized by its complex structure, which includes a pyridine ring, an amide functional group, and a long alkyl chain featuring an aminophenoxy moiety. This compound typically exhibits properties associated with both polar and non-polar characteristics due to its diverse functional groups, which can influence its solubility in various solvents. The presence of the pyridine ring suggests potential for aromatic interactions, while the amine group may participate in hydrogen bonding, enhancing its reactivity and interaction with biological systems. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in drug design, due to their ability to interact with biological targets. Additionally, the specific arrangement of functional groups can affect the compound's pharmacokinetics and pharmacodynamics, making it a subject of interest in medicinal chemistry. Overall, this compound represents a unique blend of structural features that may contribute to its biological activity and utility in research.
Formula:C17H21N3O2
InChI:InChI=1/C17H21N3O2/c18-15-6-8-16(9-7-15)22-12-3-1-2-11-20-17(21)14-5-4-10-19-13-14/h4-10,13H,1-3,11-12,18H2,(H,20,21)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Nicotinamide, N-(5-(p-aminophenoxy)pentyl)-
CAS:Nicotinamide, N-(5-(p-aminophenoxy)pentyl)- is a bioactive chemical.Formula:C17H21N3O2Color and Shape:SolidMolecular weight:299.374
