CymitQuimica logo

CAS 1015844-32-2

:

4-(1-Methylethoxy)-3-(1H-pyrazol-1-ylmethyl)benzaldehyde

Description:
4-(1-Methylethoxy)-3-(1H-pyrazol-1-ylmethyl)benzaldehyde, with the CAS number 1015844-32-2, is an organic compound characterized by its complex structure, which includes a benzaldehyde moiety, a pyrazole ring, and an ethoxy group. This compound typically exhibits properties associated with aldehydes, such as reactivity in nucleophilic addition reactions due to the presence of the carbonyl group. The presence of the pyrazole ring may impart additional biological activity, making it of interest in medicinal chemistry. The ethoxy group contributes to the compound's solubility and stability in various solvents. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The compound's specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions. Overall, this compound represents a unique combination of functional groups that may offer diverse reactivity and applications in chemical research.
Formula:C14H16N2O2
InChI:InChI=1S/C14H16N2O2/c1-11(2)18-14-5-4-12(10-17)8-13(14)9-16-7-3-6-15-16/h3-8,10-11H,9H2,1-2H3
InChI key:InChIKey=IPISKFFBJGWHOW-UHFFFAOYSA-N
SMILES:C(C1=C(OC(C)C)C=CC(C=O)=C1)N2C=CC=N2
Synonyms:
  • 4-(1-Methylethoxy)-3-(1H-pyrazol-1-ylmethyl)benzaldehyde
  • Benzaldehyde, 4-(1-methylethoxy)-3-(1H-pyrazol-1-ylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.