CAS 1015844-49-1

1-(4-Chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazole-4-acetic acid

Description:

1-(4-Chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazole-4-acetic acid, with the CAS number 1015844-49-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 4-chlorophenyl group, contributing to its aromatic properties and potential biological activity. The presence of a hydroxyl group at the 5-position and a carboxylic acid group at the 4-position of the pyrazole ring enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The methyl group at the 3-position adds to the molecular complexity and may affect the compound's steric properties. This substance is of interest in medicinal chemistry, potentially exhibiting anti-inflammatory or analgesic properties, although specific biological activities would require further investigation. Its structural characteristics suggest that it may participate in various chemical reactions, making it a candidate for further research in pharmaceutical applications.

Formula: C₁₂H₁₁ClN₂O₃

InChI: InChI=1S/C12H11ClN2O3/c1-7-10(6-11(16)17)12(18)15(14-7)9-4-2-8(13)3-5-9/h2-5,18H,6H2,1H3,(H,16,17)

InChI key: InChIKey=INHRDDJCARVXIJ-UHFFFAOYSA-N

SMILES: OC=1N(N=C(C)C1CC(O)=O)C2=CC=C(Cl)C=C2

Synonyms:

• 1H-Pyrazole-4-acetic acid, 1-(4-chlorophenyl)-5-hydroxy-3-methyl-
• 1-(4-Chlorophenyl)-5-hydroxy-3-methyl-1H-pyrazole-4-acetic acid