
CAS 1015844-93-5
:3-[(3-Pyridinylmethyl)amino]-1H-pyrazole-4-carboxamide
Description:
3-[(3-Pyridinylmethyl)amino]-1H-pyrazole-4-carboxamide, with the CAS number 1015844-93-5, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a pyridinylmethyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen atoms in its structure. It may act as a ligand or inhibitor in various biochemical pathways, making it of interest in medicinal chemistry and drug development. The carboxamide functional group contributes to its solubility and reactivity, influencing its interactions with biological targets. Additionally, the presence of the pyridine moiety can enhance its pharmacological properties, including lipophilicity and binding affinity. Overall, this compound's characteristics suggest potential applications in therapeutic contexts, particularly in the development of agents targeting specific diseases or conditions. However, detailed studies would be necessary to fully elucidate its biological activity and potential uses.
Formula:C10H11N5O
InChI:InChI=1S/C10H11N5O/c11-9(16)8-6-14-15-10(8)13-5-7-2-1-3-12-4-7/h1-4,6H,5H2,(H2,11,16)(H2,13,14,15)
InChI key:InChIKey=LBLVYSJDBWSBHZ-UHFFFAOYSA-N
SMILES:N(CC=1C=CC=NC1)C=2C(C(N)=O)=CNN2
Synonyms:- 3-[(3-Pyridinylmethyl)amino]-1H-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, 3-[(3-pyridinylmethyl)amino]-
- 3-[(Pyridin-3-ylmethyl)-amino]-1H-pyrazole-4-carboxylic acid amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.