CymitQuimica logo

CAS 1015845-52-9

:

1-(2-Fluoro-phenyl)-1H-pyrazole-4-carbaldehyde

Description:
1-(2-Fluoro-phenyl)-1H-pyrazole-4-carbaldehyde is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and reactivity. The aldehyde functional group (-CHO) at the 4-position of the pyrazole ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features can lead to diverse applications in synthetic chemistry, particularly in the design of new pharmaceuticals or agrochemicals. Additionally, the presence of fluorine can enhance lipophilicity and metabolic stability, which are valuable traits in drug design. Overall, 1-(2-Fluoro-phenyl)-1H-pyrazole-4-carbaldehyde is a versatile compound with potential implications in various fields of chemistry and biology.
Formula:C10H7FN2O
InChI:InChI=1/C10H7FN2O/c11-9-3-1-2-4-10(9)13-6-8(7-14)5-12-13/h1-7H
SMILES:c1ccc(c(c1)F)n1cc(cn1)C=O
Synonyms:
  • 1H-pyrazole-4-carboxaldehyde, 1-(2-fluorophenyl)-
  • 1-(2-Fluoro-phenyl)pyrazole-4-carbaldehyde
  • 1-(2-Fluoro-phenyl)pyrazole-4-carboxaldehyde
  • 1-(2-fluorophenyl)-1H-pyrazole-4-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.