CAS 1015845-96-1
:1-[(4-Fluorophenyl)methyl]-4-methyl-1H-pyrazol-5-amine
Description:
1-[(4-Fluorophenyl)methyl]-4-methyl-1H-pyrazol-5-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, enhancing the compound's potential for biological activity. The methyl group at the 4-position of the pyrazole ring contributes to its structural diversity and may influence its solubility and reactivity. This compound is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the pyrazole structure can lead to compounds with varying degrees of potency and selectivity for specific biological targets. Its molecular structure suggests that it may exhibit interesting interactions with biological macromolecules, making it a candidate for further research in drug development. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments.
Formula:C11H12FN3
InChI:InChI=1S/C11H12FN3/c1-8-6-14-15(11(8)13)7-9-2-4-10(12)5-3-9/h2-6H,7,13H2,1H3
InChI key:InChIKey=BYYKVAPUNIFEHX-UHFFFAOYSA-N
SMILES:C(N1C(N)=C(C)C=N1)C2=CC=C(F)C=C2
Synonyms:- 1-[(4-Fluorophenyl)methyl]-4-methyl-1H-pyrazol-5-amine
- 1H-Pyrazol-5-amine, 1-[(4-fluorophenyl)methyl]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
