CymitQuimica logo

CAS 1015846-03-3

:

4-[[6-(1H-Pyrazol-1-yl)-4-pyrimidinyl]oxy]benzaldehyde

Description:
4-[[6-(1H-Pyrazol-1-yl)-4-pyrimidinyl]oxy]benzaldehyde is a chemical compound characterized by its complex structure, which includes a benzaldehyde moiety linked to a pyrimidine and pyrazole group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, including oxidation and condensation. Additionally, the pyrazole and pyrimidine rings may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular interactions could be influenced by hydrogen bonding and π-π stacking due to its aromatic nature. Its specific applications may vary, but it could be explored in drug development or as a biochemical probe. As with many synthetic organic compounds, safety and handling precautions should be observed, given the potential reactivity of its functional groups.
Formula:C14H10N4O2
InChI:InChI=1S/C14H10N4O2/c19-9-11-2-4-12(5-3-11)20-14-8-13(15-10-16-14)18-7-1-6-17-18/h1-10H
InChI key:InChIKey=WBGLNODRVAPPED-UHFFFAOYSA-N
SMILES:O(C1=CC(=NC=N1)N2C=CC=N2)C3=CC=C(C=O)C=C3
Synonyms:
  • Benzaldehyde, 4-[[6-(1H-pyrazol-1-yl)-4-pyrimidinyl]oxy]-
  • 4-[[6-(1H-Pyrazol-1-yl)-4-pyrimidinyl]oxy]benzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.