
CAS 1015846-04-4
:3-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)benzoic acid
Description:
3-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)benzoic acid, identified by its CAS number 1015846-04-4, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group. This compound features a pyrazole ring, which contributes to its unique chemical properties, and a benzoic acid moiety that enhances its potential for hydrogen bonding and interactions with biological systems. The presence of the dimethyl groups on the pyrazole ring can influence its solubility and reactivity, making it a candidate for various applications in medicinal chemistry and material science. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, while the carboxylic acid can act as a proton donor, affecting the compound's acidity and reactivity. Overall, this compound's structural features suggest potential utility in pharmaceutical development, particularly in the design of bioactive molecules.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c1-7-11(13)8(2)15(14-7)10-5-3-4-9(6-10)12(16)17/h3-6H,13H2,1-2H3,(H,16,17)
InChI key:InChIKey=PJFLKWSUDICIDO-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1N)C2=CC(C(O)=O)=CC=C2
Synonyms:- Benzoic acid, 3-(4-amino-3,5-dimethyl-1H-pyrazol-1-yl)-
- 3-(4-Amino-3,5-dimethyl-1H-pyrazol-1-yl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, 3-(4-amino-3,5-dimethyl-1H-pyrazol-1-yl)-
CAS:Formula:C12H13N3O2Molecular weight:231.2505
