CAS 1015846-24-8: 1-Amino-N,N-diethylcyclopropanemethanamine

Description:1-Amino-N,N-diethylcyclopropanemethanamine, identified by its CAS number 1015846-24-8, is a chemical compound characterized by its unique cyclopropane structure, which contributes to its distinct reactivity and properties. This compound features an amino group and two ethyl groups attached to a cyclopropane ring, making it a tertiary amine. The presence of the amino group allows for potential hydrogen bonding, influencing its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit moderate to high polarity due to the functional groups present. The cyclopropane moiety can introduce strain, which may affect the compound's stability and reactivity, particularly in organic synthesis or medicinal chemistry applications. Additionally, the diethyl substitution can enhance lipophilicity, potentially impacting its biological activity and pharmacokinetics. Overall, 1-Amino-N,N-diethylcyclopropanemethanamine represents a class of compounds with interesting chemical behavior, making it a subject of interest in various fields, including pharmaceuticals and organic synthesis.

Formula:C₈H₁₈N₂

InChI:InChI=1S/C8H18N2/c1-3-10(4-2)7-8(9)5-6-8/h3-7,9H2,1-2H3

InChI key:InChIKey=AFLJYQVZKSWYLC-UHFFFAOYSA-N

SMILES:NC1(CN(CC)CC)CC1