CymitQuimica logo

CAS 1015846-33-9

:

1-(1-Methylethyl)cyclopropanemethanamine

Description:
1-(1-Methylethyl)cyclopropanemethanamine, also known by its CAS number 1015846-33-9, is an organic compound characterized by its unique structure that includes a cyclopropane ring and an amine functional group. This compound features a branched alkyl group, specifically isopropyl, attached to the cyclopropane, which influences its physical and chemical properties. Typically, compounds of this nature exhibit moderate polarity due to the presence of the amine group, which can engage in hydrogen bonding. The cyclopropane ring contributes to the compound's strain and reactivity, potentially making it a useful intermediate in organic synthesis. Additionally, the presence of the amine group suggests potential applications in pharmaceuticals or agrochemicals, where amine functionalities are often crucial for biological activity. The compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-(1-Methylethyl)cyclopropanemethanamine represents a fascinating example of a bicyclic amine with potential utility in various chemical applications.
Formula:C7H15N
InChI:InChI=1S/C7H15N/c1-6(2)7(5-8)3-4-7/h6H,3-5,8H2,1-2H3
InChI key:InChIKey=AGGHXCYXDNEQQJ-UHFFFAOYSA-N
SMILES:C(C)(C)C1(CN)CC1
Synonyms:
  • 1-(1-Methylethyl)cyclopropanemethanamine
  • Cyclopropanemethanamine, 1-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.