CAS 1015846-55-5
:4-(3-Azetidinyloxy)benzoic acid
Description:
4-(3-Azetidinyloxy)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and an azetidine ring connected via an ether linkage. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, while the azetidine ring may impart specific steric and electronic properties that influence its biological activity. Such compounds are often of interest in medicinal chemistry due to their potential as pharmacological agents. The molecular interactions of 4-(3-Azetidinyloxy)benzoic acid can be further explored in various applications, including drug design and synthesis. Its CAS number, 1015846-55-5, allows for precise identification and retrieval of information regarding its properties, safety data, and potential uses in research and industry. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining chemical behavior and application.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c12-10(13)7-1-3-8(4-2-7)14-9-5-11-6-9/h1-4,9,11H,5-6H2,(H,12,13)
InChI key:InChIKey=UFMKHHCJVJXUGD-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C(O)=O)C=C1)C2CNC2
Synonyms:- 4-(3-Azetidinyloxy)benzoic acid
- Benzoic acid, 4-(3-azetidinyloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.