CymitQuimica logo

CAS 1015846-76-0

:

3-Chloro-6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid

Description:
3-Chloro-6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. The presence of a chlorine atom at the 3-position and a methyl group at the 6-position contributes to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its acidity and solubility in polar solvents. It is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. The compound's molecular structure allows for various interactions with biological targets, making it a subject of interest in drug discovery. Additionally, its stability and reactivity can be influenced by the substituents on the rings, which may affect its pharmacokinetic properties. Overall, 3-Chloro-6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid is notable for its complex structure and potential applications in therapeutic contexts.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-4-2-10-7-5(9)6(8(13)14)11-12(7)3-4/h2-3H,1H3,(H,13,14)
InChI key:InChIKey=PTHOBOPZSDCKOG-UHFFFAOYSA-N
SMILES:ClC1=C2N(N=C1C(O)=O)C=C(C)C=N2
Synonyms:
  • Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 3-chloro-6-methyl-
  • 3-Chloro-6-methylpyrazolo[1,5-a]pyrimidine-2-carboxylic acid
Found 4 products.