CymitQuimica logo

CAS 1015846-77-1

:

1H-Indole-2-carboxylic acid, 1,3,7-trimethyl-

Description:
1H-Indole-2-carboxylic acid, 1,3,7-trimethyl- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group at the 2-position and three methyl groups at the 1, 3, and 7 positions of the indole ring. The presence of these functional groups contributes to its potential biological activity and solubility properties. Typically, indole derivatives are known for their roles in various biochemical processes and can exhibit a range of pharmacological effects. The compound's molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, influencing its reactivity and interactions with other molecules. Additionally, the trimethyl substitution can affect the compound's steric hindrance and electronic properties, which may be relevant in medicinal chemistry and drug design. Overall, 1H-Indole-2-carboxylic acid, 1,3,7-trimethyl- is of interest for its potential applications in pharmaceuticals and biochemistry.
Formula:C12H13NO2
InChI:InChI=1S/C12H13NO2/c1-7-5-4-6-9-8(2)11(12(14)15)13(3)10(7)9/h4-6H,1-3H3,(H,14,15)
InChI key:InChIKey=QDDROSFAMVNTTI-UHFFFAOYSA-N
SMILES:CC=1C=2C(N(C)C1C(O)=O)=C(C)C=CC2
Synonyms:
  • 1H-Indole-2-carboxylic acid, 1,3,7-trimethyl-
  • 1,3,7-Trimethyl-1H-indole-2-carboxylic acid
  • 1,3,7-Trimethylindole-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.