CymitQuimica logo

CAS 1015856-00-4

:

3-(hydroxymethyl)cyclobutane-1-carboxylic acid

Description:
3-(Hydroxymethyl)cyclobutane-1-carboxylic acid is an organic compound characterized by its cyclobutane ring structure, which is a four-membered carbon ring. The presence of a hydroxymethyl group (-CH2OH) at the third carbon position and a carboxylic acid group (-COOH) at the first carbon position contributes to its unique chemical properties. This compound is likely to exhibit both acidic behavior due to the carboxylic acid functional group and potential for hydrogen bonding due to the hydroxymethyl group. Its molecular structure suggests it may participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis. Additionally, the compound's cyclic nature may influence its reactivity and stability compared to linear analogs. While specific physical properties such as melting point, boiling point, and solubility are not provided, compounds of this type typically exhibit moderate solubility in polar solvents due to the presence of functional groups. Overall, 3-(hydroxymethyl)cyclobutane-1-carboxylic acid represents a versatile building block in organic chemistry.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c7-3-4-1-5(2-4)6(8)9/h4-5,7H,1-3H2,(H,8,9)
InChI key:IJDSDHSDNKDDER-UHFFFAOYSA-N
SMILES:C1C(CC1C(=O)O)CO
Synonyms:
  • 3-(Hydroxymethyl)cyclobutanecarboxylic acid
Found 5 products.