CAS 1015856-57-1: 1-(Ethyl-1,1,2,2,2-d5)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid
Description:1-(Ethyl-1,1,2,2,2-d5)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid is a synthetic compound characterized by its complex structure, which includes a quinoline core, a piperazine moiety, and a fluorine substituent. The presence of the ethyl group, specifically deuterated at five positions, indicates its use in studies requiring isotopic labeling, such as pharmacokinetic or metabolic investigations. This compound exhibits properties typical of quinolone derivatives, including potential antibacterial or antiviral activity, owing to its ability to interfere with bacterial DNA synthesis. The carboxylic acid functional group contributes to its solubility in polar solvents and may influence its biological activity and interaction with target proteins. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C16H13D5FN3O3
InChI:InChI=1S/C16H18FN3O3/c1-2-19-9-11(16(22)23)15(21)10-7-12(17)14(8-13(10)19)20-5-3-18-4-6-20/h7-9,18H,2-6H2,1H3,(H,22,23)/i1D3,2D2
InChI key:InChIKey=OGJPXUAPXNRGGI-ZBJDZAJPSA-N
SMILES:O=C(O)C1=CN(C2=CC(=C(F)C=C2C1=O)N3CCNCC3)CC
- Synonyms:
- 1-(Ethyl-1,1,2,2,2-d5)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid
- Norfloxacin-d5
- 3-Quinolinecarboxylic acid, 1-(ethyl-1,1,2,2,2-d5)-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-