
CAS 10159-46-3
:Pentamethylphosphoramide
Description:
Pentamethylphosphoramide (CAS 10159-46-3) is an organophosphorus compound characterized by its unique structure, which includes a phosphorus atom bonded to five methyl groups and an amide functional group. This compound is typically a colorless to pale yellow liquid with a relatively high boiling point, indicating its stability under various conditions. Pentamethylphosphoramide is known for its use as a solvent and reagent in organic synthesis, particularly in reactions involving phosphorous chemistry. It exhibits polar aprotic characteristics, making it effective in dissolving a wide range of organic compounds. Additionally, it has applications in the field of polymer chemistry and as a catalyst in certain reactions. The compound is also recognized for its ability to stabilize reactive intermediates, which can enhance reaction yields. However, due to its phosphorus content, it should be handled with care, as it may pose environmental and health risks if not managed properly. Overall, pentamethylphosphoramide is a versatile chemical with significant utility in various chemical processes.
Formula:C5H16N3OP
InChI:InChI=1S/C5H16N3OP/c1-6-10(9,7(2)3)8(4)5/h1-5H3,(H,6,9)
InChI key:InChIKey=JSJBYUNWLNWERF-UHFFFAOYSA-N
SMILES:P(N(C)C)(N(C)C)(NC)=O
Synonyms:- Phosphoric triamide, pentamethyl-
- Pentamethylphosphoric triamide
- N,N,N′,N′,N′′-Pentamethylphosphoric triamide
- Phosphoric triamide, N,N,N′,N′,N′′-pentamethyl-
- Pentamethylphosphoramide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
