CAS 1016-40-6

Ethyl 2-methyl-5-nitro-1H-imidazole-1-acetate

Description:

Ethyl 2-methyl-5-nitro-1H-imidazole-1-acetate, with the CAS number 1016-40-6, is a chemical compound that belongs to the class of imidazole derivatives. It features a nitro group and an acetate moiety, contributing to its unique chemical properties. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The imidazole ring is known for its aromaticity and ability to participate in hydrogen bonding, which can affect solubility and interaction with biological systems. Ethyl 2-methyl-5-nitro-1H-imidazole-1-acetate may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of solvents. Overall, this compound's structural features suggest potential applications in medicinal chemistry and as a building block for more complex molecules.

Formula: C₈H₁₁N₃O₄

InChI: InChI=1S/C8H11N3O4/c1-3-15-8(12)5-10-6(2)9-4-7(10)11(13)14/h4H,3,5H2,1-2H3

InChI key: InChIKey=CKGGIKOPFUMXET-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)N1C(N(=O)=O)=CN=C1C

Synonyms:

• Ethyl 2-methyl-5-nitro-1H-imidazole-1-acetate
• Imidazole-1-acetic acid, 2-methyl-5-nitro-, ethyl ester
• 1H-Imidazole-1-acetic acid, 2-methyl-5-nitro-, ethyl ester