CAS 1016-59-7

1-Methylphenazine

Description:

1-Methylphenazine is an organic compound characterized by its phenazine backbone, which consists of two fused benzene rings and a nitrogen-containing heterocycle. This compound features a methyl group attached to one of the nitrogen atoms in the phenazine structure, influencing its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. 1-Methylphenazine is known for its potential applications in organic electronics, particularly in the development of organic semiconductors and photovoltaic devices. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. The compound is soluble in organic solvents, and its stability can be affected by environmental factors such as light and temperature. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks upon exposure. Overall, 1-Methylphenazine is a significant compound in both industrial and research contexts due to its unique structural features and potential applications.

Formula: C₁₃H₁₀N₂

InChI: InChI=1S/C13H10N2/c1-9-5-4-8-12-13(9)15-11-7-3-2-6-10(11)14-12/h2-8H,1H3

InChI key: InChIKey=WBVSERCLMQZOBK-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C3C(=N2)C=CC=C3)C=CC1

Synonyms:

• Phenazine, 1-methyl-
• 1-Methylphenazine