CAS 1016-82-6

1-Chloro-4-(phenylsulfinyl)benzene

Description:

1-Chloro-4-(phenylsulfinyl)benzene, with the CAS number 1016-82-6, is an organic compound characterized by the presence of a chloro group and a phenylsulfinyl group attached to a benzene ring. This compound features a sulfinyl functional group, which consists of a sulfur atom bonded to an oxygen atom and a phenyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid at room temperature and is soluble in organic solvents such as dichloromethane and acetone. The presence of the chloro substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the sulfinyl group can impart specific electronic properties, affecting the compound's behavior in chemical processes. 1-Chloro-4-(phenylsulfinyl)benzene may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals, highlighting its significance in the field of synthetic organic chemistry.

Formula: C₁₂H₉ClOS

InChI: InChI=1/C12H9ClOS/c13-10-6-8-12(9-7-10)15(14)11-4-2-1-3-5-11/h1-9H

InChI key: InChIKey=XRVFHWFVEIJJKX-UHFFFAOYSA-N

SMILES: S(=O)(C1=CC=C(Cl)C=C1)C2=CC=CC=C2

Synonyms:

• p-Chlorophenyl phenyl sulfoxide
• 1-Chloro-4-(phenylsulfinyl)benzene
• Benzene, 1-chloro-4-(phenylsulfinyl)-
• Phenyl p-chlorophenyl sulfoxide
• Sulfoxide, p-chlorophenyl phenyl

(R)-p-Chlorophenyl phenyl sulfoxide

CAS: 1016-82-6

Formula: C₁₂H₉ClOS

Molecular weight: 236.7173

Ref: IN-DA0004Y0