CAS 101623-71-6

Carbonic acid, iodomethyl 4-nitrophenyl ester

Description:

Carbonic acid, iodomethyl 4-nitrophenyl ester, also known by its CAS number 101623-71-6, is an organic compound characterized by its ester functional group derived from carbonic acid and 4-nitrophenol. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. It features a nitro group, which contributes to its electron-withdrawing properties, enhancing its reactivity in various chemical reactions. The presence of the iodomethyl group suggests potential applications in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Its stability and reactivity can be influenced by environmental conditions, such as pH and temperature. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards. Overall, carbonic acid, iodomethyl 4-nitrophenyl ester is a versatile compound with potential applications in both research and industry.

Formula: C₈H₆INO₅

InChI: InChI=1S/C8H6INO5/c9-5-14-8(11)15-7-3-1-6(2-4-7)10(12)13/h1-4H,5H2

InChI key: InChIKey=NZKQUJFOPJXEFF-UHFFFAOYSA-N

SMILES: O(C(OCI)=O)C1=CC=C(N(=O)=O)C=C1

Synonyms:

• Iodomethyl 4-nitrophenyl carbonate
• Carbonic acid, iodomethyl 4-nitrophenyl ester