CAS 1016231-40-5

B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid

Description:

B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorinated aromatic ring. This compound features a bromine atom and four fluorine substituents on the phenyl ring, which significantly influence its chemical reactivity and physical properties. The boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. The presence of multiple electronegative fluorine atoms enhances the compound's polarity and can affect its solubility in different solvents. Additionally, the bromine substituent can serve as a site for further functionalization. Overall, this compound is of interest in the development of pharmaceuticals and agrochemicals, as well as in the study of boron chemistry. Its unique structure and reactivity profile make it a useful building block in synthetic organic chemistry.

Formula: C₆H₂BBrF₄O₂

InChI: InChI=1S/C6H2BBrF4O2/c8-2-5(11)3(9)1(7(13)14)4(10)6(2)12/h13-14H

InChI key: InChIKey=WFADCDXWIFNRJC-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(F)C(F)=C(Br)C(F)=C1F

Synonyms:

• (4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid
• Boronic acid, B-(4-bromo-2,3,5,6-tetrafluorophenyl)-
• B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid

4-Bromo-2,3,5,6-tetrafluorophenylboronic acid

CAS: 1016231-40-5

Formula: C₆H₂BBrF₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 272.7875

Ref: IN-DA000502

4-Bromo-2,3,5,6-tetrafluorophenylboronic acid

CAS: 1016231-40-5

4-Bromo-2,3,5,6-tetrafluorophenylboronic acid

Purity: 95%

Molecular weight: 272.79g/mol

Ref: 54-PC901437

(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid

CAS: 1016231-40-5

Purity: 95%

Molecular weight: 272.7900085

Ref: 10-F696332