CAS 1016231-40-5: B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid
Description:B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorinated aromatic ring. This compound features a bromine atom and four fluorine substituents on the phenyl ring, which significantly influence its chemical reactivity and physical properties. The boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. The presence of multiple electronegative fluorine atoms enhances the compound's polarity and can affect its solubility in different solvents. Additionally, the bromine substituent can serve as a site for further functionalization. Overall, this compound is of interest in the development of pharmaceuticals and agrochemicals, as well as in the study of boron chemistry. Its unique structure and reactivity profile make it a useful building block in synthetic organic chemistry.
Formula:C6H2BBrF4O2
InChI:InChI=1S/C6H2BBrF4O2/c8-2-5(11)3(9)1(7(13)14)4(10)6(2)12/h13-14H
InChI key:InChIKey=WFADCDXWIFNRJC-UHFFFAOYSA-N
SMILES:FC=1C(F)=C(B(O)O)C(F)=C(F)C1Br
- Synonyms:
- (4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid
- Boronic acid, B-(4-bromo-2,3,5,6-tetrafluorophenyl)-
- B-(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid

Boronic acid, B-(4-bromo-2,3,5,6-tetrafluorophenyl)-
Ref: IN-DA000502
1g | 203.00 € | ||
5g | To inquire | ||
100mg | 80.00 € | ||
250mg | 108.00 € |

Ref: 54-PC901437
1g | 411.00 € | ||
5g | 1,260.00 € | ||
100mg | 103.00 € | ||
250mg | 177.00 € |

(4-Bromo-2,3,5,6-tetrafluorophenyl)boronic acid
Ref: 10-F696332
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

4-Bromo-2,3,5,6-tetrafluorophenylboronic acid
Ref: 3D-FB89556
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |