CymitQuimica logo

CAS 1016241-78-3

:

3-Fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:
3-Fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a fluorine atom at the 3-position of the pyrrole ring enhances its reactivity and can influence its biological activity. This compound features a carboxylic acid functional group, which imparts acidic properties and allows for potential interactions in various chemical environments. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways. Its structural characteristics suggest that it may participate in hydrogen bonding and other intermolecular interactions, making it a candidate for further research in pharmacology and material science. As with many heterocycles, its reactivity can be influenced by the electronic effects of the substituents on the ring system.
Formula:C8H5FN2O2
InChI:InChI=1S/C8H5FN2O2/c9-5-4-2-1-3-10-7(4)11-6(5)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=OQJOLHZGFNPOQC-UHFFFAOYSA-N
SMILES:FC=1C=2C(NC1C(O)=O)=NC=CC2
Synonyms:
  • 3-Fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
  • 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 3-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.