CAS 1016241-81-8

4-Fluoro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid

Description:

4-Fluoro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. The presence of a fluorine atom at the 4-position and a carboxylic acid functional group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the fluorine atom that can enhance metabolic stability and bioactivity. Additionally, the compound may exhibit interesting properties such as antimicrobial or anticancer activities, making it a subject of interest in drug discovery research. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₄FN₃O₂

InChI: InChI=1S/C7H4FN3O2/c8-5-3-1-4(7(12)13)11-6(3)10-2-9-5/h1-2H,(H,12,13)(H,9,10,11)

InChI key: InChIKey=PAYLIYUKVLBCRG-UHFFFAOYSA-N

SMILES: FC1=C2C(NC(C(O)=O)=C2)=NC=N1

Synonyms:

• 4-Fluoro-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid
• 7H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 4-fluoro-

7H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 4-fluoro-

CAS: 1016241-81-8

Formula: C₇H₄FN₃O₂

Purity: 95%

Molecular weight: 181.1240

Ref: IN-DA0004ZU