CAS 101630-94-8

N-[6-(2,2-DIMETHYL-PROPIONYLAMINO)-PYRIDIN-2-YL]-2,2-DIMETHYL-PROPIONAMIDE

Description:

N-[6-(2,2-Dimethyl-propionylamino)-pyridin-2-yl]-2,2-dimethyl-propionamide, with CAS number 101630-94-8, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a propionylamino group. This compound is typically classified as an amide due to the presence of the amide functional group (-C(=O)N-). The presence of multiple methyl groups contributes to its steric bulk and may influence its solubility and reactivity. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where the pyridine moiety can enhance biological activity. Additionally, the dimethyl groups may provide lipophilicity, affecting the compound's pharmacokinetics. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₅H₂₃N₃O₂

InChI: InChI=1/C15H23N3O2/c1-14(2,3)12(19)17-10-8-7-9-11(16-10)18-13(20)15(4,5)6/h7-9H,1-6H3,(H2,16,17,18,19,20)

SMILES: CC(C)(C)C(=Nc1cccc(n1)N=C(C(C)(C)C)O)O

Synonyms:

• N,N'-pyridine-2,6-diylbis(2,2-dimethylpropanamide)

Propanamide, N,N'-2,6-pyridinediylbis[2,2-dimethyl-

CAS: 101630-94-8

Formula: C₁₅H₂₃N₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 277.3620

Ref: IN-DA00050Q

N,N'-(Pyridine-2,6-diyl)bis(2,2-dimethylpropanamide)

CAS: 101630-94-8

N,N'-(Pyridine-2,6-diyl)bis(2,2-dimethylpropanamide)

Purity: 97%

Molecular weight: 277.36g/mol

Ref: 54-OR93229

N,N’-(Pyridine-2,6-diyl)bis(2,2-dimethylpropanamide)

CAS: 101630-94-8

Purity: 97%

Molecular weight: 277.3680115

Ref: 10-F608681