CAS 1016506-35-6
:N-Hydroxy-4-methyl-1-piperidineethanimidamide
Description:
N-Hydroxy-4-methyl-1-piperidineethanimidamide is a chemical compound characterized by its unique structure, which includes a piperidine ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both amides and hydroxylamines, such as potential reactivity in nucleophilic substitution reactions. The presence of the piperidine ring contributes to its basicity and can influence its solubility in various solvents. Additionally, the methyl group at the 4-position of the piperidine ring may affect steric hindrance and electronic properties, potentially impacting its biological activity and interactions with other molecules. N-Hydroxy-4-methyl-1-piperidineethanimidamide may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential role as a reactive intermediate or a bioactive compound. As with many chemical substances, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be assessed through appropriate studies.
Formula:C8H17N3O
InChI:InChI=1S/C8H17N3O/c1-7-2-4-11(5-3-7)6-8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10)
InChI key:InChIKey=DBBRRHLPTHXQNN-UHFFFAOYSA-N
SMILES:C(C(NO)=N)N1CCC(C)CC1
Synonyms:- N-Hydroxy-4-methyl-1-piperidineethanimidamide
- 1-Piperidineethanimidamide, N-hydroxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.