CAS 1016507-27-9
:2-(2-Bromo-5-fluorophenyl)-5-benzoxazolamine
Description:
2-(2-Bromo-5-fluorophenyl)-5-benzoxazolamine is a chemical compound characterized by its complex structure, which includes a benzoxazole moiety and a bromo-fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in medicinal chemistry and material science. The presence of bromine and fluorine substituents can influence its reactivity and solubility, often enhancing biological activity or altering physical properties. The benzoxazole ring is known for its stability and ability to participate in various chemical reactions, making this compound of interest in the development of pharmaceuticals. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, 2-(2-Bromo-5-fluorophenyl)-5-benzoxazolamine represents a unique structure that may offer diverse applications in research and industry, particularly in the fields of drug discovery and organic synthesis.
Formula:C13H8BrFN2O
InChI:InChI=1S/C13H8BrFN2O/c14-10-3-1-7(15)5-9(10)13-17-11-6-8(16)2-4-12(11)18-13/h1-6H,16H2
InChI key:InChIKey=YSPVGBUPECVFLV-UHFFFAOYSA-N
SMILES:BrC1=C(C=2OC=3C(N2)=CC(N)=CC3)C=C(F)C=C1
Synonyms:- 5-Benzoxazolamine, 2-(2-bromo-5-fluorophenyl)-
- 2-(2-Bromo-5-fluorophenyl)-5-benzoxazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
