CAS 1016507-96-2

1-(3-Methoxybenzoyl)-4-piperidinone 4-oxime

Description:

1-(3-Methoxybenzoyl)-4-piperidinone 4-oxime, identified by its CAS number 1016507-96-2, is a chemical compound characterized by its unique structural features. It contains a piperidinone core, which is a six-membered ring with a nitrogen atom, and is substituted with a methoxybenzoyl group and an oxime functional group. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility. The oxime functional group, characterized by the presence of a C=N-OH bond, is known for its reactivity and can participate in various chemical reactions, including those involving nucleophiles. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(3-Methoxybenzoyl)-4-piperidinone 4-oxime represents a complex organic molecule with potential applications in drug development and chemical research.

Formula: C₁₃H₁₆N₂O₃

InChI: InChI=1S/C13H16N2O3/c1-18-12-4-2-3-10(9-12)13(16)15-7-5-11(14-17)6-8-15/h2-4,9,17H,5-8H2,1H3

InChI key: InChIKey=HGXBFGRXHREYIC-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC)=CC=C1)N2CCC(=NO)CC2

Synonyms:

• 4-Piperidinone, 1-(3-methoxybenzoyl)-, 4-oxime
• 1-(3-Methoxybenzoyl)-4-piperidinone 4-oxime