CymitQuimica logo

CAS 101651-56-3

:

N-[3-[2-(bis(2-bromoethyl)amino)ethyl]-4-methoxy-phenyl]acetamide

Description:
N-[3-[2-(bis(2-bromoethyl)amino)ethyl]-4-methoxy-phenyl]acetamide, with CAS number 101651-56-3, is a synthetic organic compound characterized by its complex structure, which includes a methoxy group, an acetamide functional group, and a bis(2-bromoethyl)amino moiety. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity due to the presence of the bromoethyl groups, which can participate in nucleophilic substitution reactions. The methoxy group may influence its electronic properties and steric hindrance, affecting its biological activity and interaction with other molecules. The presence of bromine atoms suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as brominated compounds often exhibit unique biological activities. Overall, this compound's characteristics make it of interest in various fields, including drug development and chemical synthesis, although specific physical properties such as melting point, boiling point, and spectral data would require empirical determination.
Formula:C15H22Br2N2O2
InChI:InChI=1/C15H22Br2N2O2/c1-12(20)18-14-3-4-15(21-2)13(11-14)5-8-19(9-6-16)10-7-17/h3-4,11H,5-10H2,1-2H3,(H,18,20)
Synonyms:
  • 3'-(2-(Bis(2-bromoethyl)amino)ethyl)-4'-methoxyacetanilide
  • 3-Bis(2-bromoethyl)aminoethyl-4-methoxy-acetamidobenzene
  • Acetanilide, 3'-(2-(bis(2-bromoethyl)amino)ethyl)-4'-methoxy-
  • N-(3-{2-[bis(2-bromoethyl)amino]ethyl}-4-methoxyphenyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.