CAS 1016516-69-0

N-(3-Aminophenyl)-4-ethoxybenzamide

Description:

N-(3-Aminophenyl)-4-ethoxybenzamide is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a 4-ethoxybenzamide moiety, indicating the presence of an ethoxy group (-OCH2CH3) attached to a benzene ring, as well as a 3-aminophenyl group, which consists of an amino group (-NH2) positioned on the third carbon of a phenyl ring. The presence of these functional groups suggests that the compound may exhibit properties such as solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. Its structure may allow for interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's molecular weight, melting point, and other physical properties would be determined by its specific molecular structure and the arrangement of its atoms. Overall, N-(3-Aminophenyl)-4-ethoxybenzamide represents a class of compounds that may have applications in drug development and other chemical research fields.

Formula: C₁₅H₁₆N₂O₂

InChI: InChI=1S/C15H16N2O2/c1-2-19-14-8-6-11(7-9-14)15(18)17-13-5-3-4-12(16)10-13/h3-10H,2,16H2,1H3,(H,17,18)

InChI key: InChIKey=PYLURQYVLUALLE-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=C(OCC)C=C1)C2=CC(N)=CC=C2

Synonyms:

• N-(3-Aminophenyl)-4-ethoxybenzamide
• Benzamide, N-(3-aminophenyl)-4-ethoxy-