CAS 1016529-13-7

2,3-Dihydro-2-methyl-1H-indole-1-propanamine

Description:

2,3-Dihydro-2-methyl-1H-indole-1-propanamine, identified by its CAS number 1016529-13-7, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure comprising a fused benzene and pyrrole ring. This compound features a propanamine side chain, which contributes to its potential biological activity. Typically, indole derivatives are known for their diverse pharmacological properties, including effects on the central nervous system and potential applications in medicinal chemistry. The presence of the dihydro and methyl groups in its structure may influence its solubility, stability, and reactivity. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Due to its structural features, 2,3-Dihydro-2-methyl-1H-indole-1-propanamine may be of interest in research related to drug development and synthesis of novel therapeutic agents.

Formula: C₁₂H₁₈N₂

InChI: InChI=1S/C12H18N2/c1-10-9-11-5-2-3-6-12(11)14(10)8-4-7-13/h2-3,5-6,10H,4,7-9,13H2,1H3

InChI key: InChIKey=KSXVGIDENYOTMO-UHFFFAOYSA-N

SMILES: C(CCN)N1C=2C(CC1C)=CC=CC2

Synonyms:

• 1H-Indole-1-propanamine, 2,3-dihydro-2-methyl-
• 2,3-Dihydro-2-methyl-1H-indole-1-propanamine