CAS 1016538-89-8
:1-[(4-Fluorophenyl)sulfonyl]-3-piperidinol
Description:
1-[(4-Fluorophenyl)sulfonyl]-3-piperidinol is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a sulfonyl group attached to a 4-fluorophenyl moiety indicates that this compound has both aromatic and polar functional groups, contributing to its potential reactivity and solubility properties. The fluorine atom on the phenyl ring can enhance the compound's lipophilicity and may influence its biological activity. This compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the context of targeting specific biological pathways. Its structural features suggest that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in various biochemical processes. As with many sulfonamide derivatives, it may also possess unique interactions with biological targets due to the presence of the sulfonyl group, which can participate in hydrogen bonding and other non-covalent interactions.
Formula:C11H14FNO3S
InChI:InChI=1S/C11H14FNO3S/c12-9-3-5-11(6-4-9)17(15,16)13-7-1-2-10(14)8-13/h3-6,10,14H,1-2,7-8H2
InChI key:InChIKey=JEPDCFNFCAHXDP-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(F)C=C1)N2CC(O)CCC2
Synonyms:- 3-Piperidinol, 1-[(4-fluorophenyl)sulfonyl]-
- 1-[(4-Fluorophenyl)sulfonyl]-3-piperidinol
- 1-(4-Fluorobenzenesulfonyl)piperidin-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.