CAS 101655-92-9
:Cinchonan-9-ol, 6′-methoxy-, 1,1′-dioxide, (8α,9R)-
Description:
Cinchonan-9-ol, 6′-methoxy-, 1,1′-dioxide, (8α,9R)-, with CAS number 101655-92-9, is a chemical compound derived from the cinchona alkaloids, which are known for their medicinal properties, particularly in the treatment of malaria. This compound features a complex bicyclic structure typical of cinchona derivatives, characterized by a quinoline ring system. The presence of a methoxy group at the 6′ position and a hydroxyl group at the 9 position contributes to its biological activity and solubility properties. The 1,1′-dioxide functional group indicates the presence of two oxygen atoms bonded to the nitrogen in the quinoline structure, which can influence its reactivity and interaction with biological targets. As a chiral molecule, it exhibits stereoisomerism, with the specified configuration at the 8α and 9R positions playing a crucial role in its pharmacological effects. Overall, this compound is of interest in medicinal chemistry for its potential therapeutic applications and its role in the development of antimalarial agents.
Formula:C20H24N2O4
InChI:InChI=1/C20H24N2O4/c1-3-13-12-22(25)9-7-14(13)10-19(22)20(23)16-6-8-21(24)18-5-4-15(26-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14?,19-,20+,22?/m0/s1
InChI key:InChIKey=BTIIQUQYRAFYJP-CURGQOQWSA-N
SMILES:[C@H](O)([C@]1(N2(=O)C[C@H](C=C)[C@](C1)(CC2)[H])[H])C=3C4=C(N(=O)=CC3)C=CC(OC)=C4
Synonyms:- (8a,9R)-6'-Methoxy-cinchonan-9-ol 1,1'-Dioxide
- Cinchonan-9-ol, 6′-methoxy-, 1,1′-dioxide, (8α,9R)-
- Quinine N,N'-Dioxide
- Quinine Di-N-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Cinchonan-9-ol, 6'-methoxy-, 1,1'-dioxide, (8α,9R)-
CAS:Formula:C20H24N2O4Color and Shape:SolidMolecular weight:356.4156Quinine Di-N-oxide
CAS:Controlled ProductApplications A metabolite of Quinine.
References Christie, D.J., et al.: J. Lab. Clin. Med., 112, 92 (1988).Formula:C20H24N2O4Color and Shape:NeatMolecular weight:356.42


