CAS 10166-40-2

2-[(2-Iodophenyl)amino]benzoic acid

Description:

2-[(2-Iodophenyl)amino]benzoic acid, with the CAS number 10166-40-2, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and an amino group attached to a 2-iodophenyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, such as the ability to form hydrogen bonds due to the presence of the amino and carboxylic acid functional groups. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as an intermediate in organic synthesis. The iodine substituent can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Additionally, the presence of the amino group may impart basicity, allowing for protonation under acidic conditions. Overall, this compound's unique structure contributes to its potential utility in various chemical and biological applications.

Formula: C₁₃H₁₀INO₂

InChI: InChI=1S/C13H10INO2/c14-10-6-2-4-8-12(10)15-11-7-3-1-5-9(11)13(16)17/h1-8,15H,(H,16,17)

InChI key: InChIKey=KWWDONSFOGGYSE-UHFFFAOYSA-N

SMILES: N(C1=C(C(O)=O)C=CC=C1)C2=C(I)C=CC=C2

Synonyms:

• Anthranilic acid, N-(o-iodophenyl)-
• 2-[(2-Iodophenyl)amino]benzoic acid
• Benzoic acid, 2-[(2-iodophenyl)amino]-

2-[(2-Iodophenyl)amino]benzoic acid

CAS: 10166-40-2

Formula: C₁₃H₁₀INO₂

Molecular weight: 339.1285

Ref: IN-DA00054E