CAS 1016642-07-1

2-Thiazole-4-boronic acid

Description:

2-Thiazole-4-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a thiazole ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid moiety. The thiazole ring contributes to its heterocyclic nature, which can influence its reactivity and interactions in various chemical environments. 2-Thiazole-4-boronic acid is often utilized in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a boron source for the formation of carbon-carbon bonds. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. The compound's properties, such as acidity and reactivity, can be influenced by the electronic effects of the thiazole ring and the boronic acid group, allowing for diverse applications in both synthetic and pharmaceutical chemistry.

Formula: C₃H₄BNO₂S

InChI: InChI=1S/C3H4BNO2S/c6-4(7)3-1-8-2-5-3/h1-2,6-7H

SMILES: c1c(B(O)O)ncs1

Synonyms:

• Thiazol-4-ylboronicacid

Boronic acid, B-4-thiazolyl-

CAS: 1016642-07-1

Formula: C₃H₄BNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 128.9454

Ref: IN-DA00053V

Thiazol-4-ylboronic acid

CAS: 1016642-07-1

Purity: ≥95%

Molecular weight: 128.9400024

Ref: 10-F692492

Thiazol-4-ylboronic Acid

Controlled Product

CAS: 1016642-07-1

Applications Thiazol-4-ylboronic acid (cas# 1016642-07-1) is a useful research chemical.

Formula: C₃H₄BNO₂S

Color and Shape: Neat

Molecular weight: 128.945

Ref: TR-T344720