CAS 1016677-08-9

3-(4-Chloro-2-fluorophenyl)-1H-1,2,4-triazol-5-amine

Description:

3-(4-Chloro-2-fluorophenyl)-1H-1,2,4-triazol-5-amine is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. The presence of the 4-chloro-2-fluorophenyl group indicates that the compound has both chlorine and fluorine substituents on the aromatic ring, which can influence its biological activity and chemical reactivity. This compound is typically classified as an amine due to the presence of an amino group (-NH2) attached to the triazole ring. Its unique structure may confer specific properties, such as potential antimicrobial or antifungal activity, making it of interest in pharmaceutical research. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, the CAS number 1016677-08-9 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, this compound exemplifies the diverse chemistry associated with heterocyclic compounds and their derivatives.

Formula: C₈H₆ClFN₄

InChI: InChI=1S/C8H6ClFN4/c9-4-1-2-5(6(10)3-4)7-12-8(11)14-13-7/h1-3H,(H3,11,12,13,14)

InChI key: InChIKey=WDMANTCWRFJMIJ-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(Cl)=C1)C=2NC(N)=NN2

Synonyms:

• 3-(4-Chloro-2-fluorophenyl)-1H-1,2,4-triazol-5-amine
• 1H-1,2,4-Triazol-5-amine, 3-(4-chloro-2-fluorophenyl)-