CAS 1016683-04-7

N-[4-(Aminomethyl)phenyl]-3-[methyl(phenylmethyl)amino]propanamide

Description:

N-[4-(Aminomethyl)phenyl]-3-[methyl(phenylmethyl)amino]propanamide, identified by its CAS number 1016683-04-7, is a synthetic organic compound characterized by its complex molecular structure, which includes an amide functional group and multiple aromatic rings. This compound features a phenyl group substituted with an aminomethyl group, contributing to its potential biological activity. The presence of a methyl(phenylmethyl)amino group indicates that it may exhibit properties typical of amines, such as basicity and potential reactivity with electrophiles. Its molecular structure suggests that it may interact with biological targets, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, its pharmacological properties would need to be evaluated through experimental studies to determine its efficacy and safety profile in potential therapeutic applications. Overall, this compound exemplifies the complexity and diversity of synthetic organic molecules used in research and development.

Formula: C₁₈H₂₃N₃O

InChI: InChI=1S/C18H23N3O/c1-21(14-16-5-3-2-4-6-16)12-11-18(22)20-17-9-7-15(13-19)8-10-17/h2-10H,11-14,19H2,1H3,(H,20,22)

InChI key: InChIKey=IYFLUPZUCRRCIR-UHFFFAOYSA-N

SMILES: N(C(CCN(CC1=CC=CC=C1)C)=O)C2=CC=C(CN)C=C2

Synonyms:

• N-[4-(Aminomethyl)phenyl]-3-[methyl(phenylmethyl)amino]propanamide
• Propanamide, N-[4-(aminomethyl)phenyl]-3-[methyl(phenylmethyl)amino]-

N-[4-(Aminomethyl)phenyl]-3-[benzyl(methyl)amino]propanamide

CAS: 1016683-04-7

Versatile small molecule scaffold

Formula: C₁₈H₂₃N₃O

Purity: Min. 95%

Molecular weight: 297.4 g/mol

Ref: 3D-RQB68304