CAS 1016696-49-3

4-[[(Propylsulfonyl)amino]methyl]benzenesulfonyl chloride

Description:

4-[[(Propylsulfonyl)amino]methyl]benzenesulfonyl chloride, identified by its CAS number 1016696-49-3, is a sulfonamide compound characterized by the presence of both sulfonyl and amine functional groups. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its reactivity due to the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. The propylsulfonyl group contributes to its solubility and potential biological activity. As a sulfonamide, it may exhibit antibacterial properties, although its specific biological effects would depend on the context of its use and the presence of other functional groups. Safety considerations are important when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines. Proper storage and handling protocols should be followed to ensure safety in laboratory settings.

Formula: C₁₀H₁₄ClNO₄S₂

InChI: InChI=1S/C10H14ClNO4S2/c1-2-7-17(13,14)12-8-9-3-5-10(6-4-9)18(11,15)16/h3-6,12H,2,7-8H2,1H3

InChI key: InChIKey=UVTWTLUVLMNEKY-UHFFFAOYSA-N

SMILES: C(NS(CCC)(=O)=O)C1=CC=C(S(Cl)(=O)=O)C=C1

Synonyms:

• 4-[[(Propylsulfonyl)amino]methyl]benzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-[[(propylsulfonyl)amino]methyl]-

4-[(Propane-1-sulfonamido)methyl]benzene-1-sulfonyl chloride

CAS: 1016696-49-3

Versatile small molecule scaffold

Formula: C₁₀H₁₄ClNO₄S₂

Purity: Min. 95%

Molecular weight: 311.8 g/mol

Ref: 3D-RQB69649