
CAS 1016698-42-2: 5-Amino-1-(3-methylbutyl)-2(1H)-pyridinone
Description:5-Amino-1-(3-methylbutyl)-2(1H)-pyridinone is an organic compound characterized by its pyridinone structure, which features a pyridine ring with an amino group and a branched alkyl substituent. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The 3-methylbutyl side chain contributes to its hydrophobic character, influencing its overall solubility and reactivity. The presence of the amino group suggests potential basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its stability under standard conditions is generally good, although it may be sensitive to extreme pH or temperature variations. Overall, 5-Amino-1-(3-methylbutyl)-2(1H)-pyridinone is a versatile compound with potential applications in medicinal chemistry and related fields.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-8(2)5-6-12-7-9(11)3-4-10(12)13/h3-4,7-8H,5-6,11H2,1-2H3
InChI key:InChIKey=YSNPVBCQLMWIOS-UHFFFAOYSA-N
SMILES:O=C1C=CC(N)=CN1CCC(C)C
- Synonyms:
- 2(1H)-Pyridinone, 5-amino-1-(3-methylbutyl)-
- 5-Amino-1-(3-methylbutyl)-2(1H)-pyridinone
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Amino-1-isopentylpyridin-2(1h)-one REF: 10-F742717CAS: 1016698-42-2 | 95% | - - - | Discontinued product |
![]() | 5-Amino-1-(3-methylbutyl)-1,2-dihydropyridin-2-one REF: 3D-RQB69842CAS: 1016698-42-2 | Min. 95% | - - - | Discontinued product |

Ref: 10-F742717
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

5-Amino-1-(3-methylbutyl)-1,2-dihydropyridin-2-one
Ref: 3D-RQB69842
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |