CymitQuimica logo

CAS 1016717-55-7

:

2-[(Cyclopropylamino)methyl]benzonitrile

Description:
2-[(Cyclopropylamino)methyl]benzonitrile is an organic compound characterized by its unique structural features, which include a benzonitrile moiety and a cyclopropylamino group. The presence of the nitrile functional group (-C≡N) contributes to its potential reactivity and polarity, while the cyclopropylamine component introduces strain and unique steric properties due to the three-membered cyclopropyl ring. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic functional groups that can interact with biological targets. Additionally, the compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H12N2
InChI:InChI=1S/C11H12N2/c12-7-9-3-1-2-4-10(9)8-13-11-5-6-11/h1-4,11,13H,5-6,8H2
InChI key:InChIKey=ITRRZHUQZZXIDI-UHFFFAOYSA-N
SMILES:C(NC1CC1)C2=C(C#N)C=CC=C2
Synonyms:
  • Benzonitrile, 2-[(cyclopropylamino)methyl]-
  • 2-[(Cyclopropylamino)methyl]benzonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.