
CAS 1016735-73-1
:2-[4-(Difluoromethoxy)phenyl]pyrrolidine
Description:
2-[4-(Difluoromethoxy)phenyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a phenyl group substituted with a difluoromethoxy moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the difluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine ring can participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Additionally, the compound's molecular geometry and electronic properties can affect its solubility, stability, and interaction with biological targets. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in pharmaceuticals or agrochemicals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C11H13F2NO
InChI:InChI=1S/C11H13F2NO/c12-11(13)15-9-5-3-8(4-6-9)10-2-1-7-14-10/h3-6,10-11,14H,1-2,7H2
InChI key:InChIKey=ZOFPKLFIGVGEBK-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=CC=C(C=C1)C2CCCN2
Synonyms:- 2-[4-(Difluoromethoxy)phenyl]pyrrolidine
- Pyrrolidine, 2-[4-(difluoromethoxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.