
CAS 1016749-43-1
:α-Cyclobutyl-4-methylbenzenemethanamine
Description:
α-Cyclobutyl-4-methylbenzenemethanamine, identified by its CAS number 1016749-43-1, is an organic compound characterized by its unique structure that includes a cyclobutyl group and a 4-methylbenzenemethanamine moiety. This compound features a cyclobutane ring, which contributes to its cyclic nature and may influence its physical and chemical properties, such as stability and reactivity. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, which could affect its solubility in various solvents. Additionally, the methyl group on the benzene ring may enhance its lipophilicity, potentially impacting its biological activity and interactions with other molecules. While specific data on its melting point, boiling point, and other physical properties may not be readily available, compounds of this type are often studied for their potential applications in pharmaceuticals and materials science due to their structural diversity and functional capabilities.
Formula:C12H17N
InChI:InChI=1S/C12H17N/c1-9-5-7-11(8-6-9)12(13)10-3-2-4-10/h5-8,10,12H,2-4,13H2,1H3
InChI key:InChIKey=HJUBVJHETMKCEY-UHFFFAOYSA-N
SMILES:C(N)(C1=CC=C(C)C=C1)C2CCC2
Synonyms:- α-Cyclobutyl-4-methylbenzenemethanamine
- Benzenemethanamine, α-cyclobutyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.