
CAS 1016765-84-6
:[1-(4-Fluorophenyl)propyl]hydrazine
Description:
[1-(4-Fluorophenyl)propyl]hydrazine, with the CAS number 1016765-84-6, is an organic compound characterized by the presence of a hydrazine functional group attached to a propyl chain that is further substituted with a para-fluorophenyl group. This compound typically exhibits properties associated with both hydrazines and aromatic compounds, including potential reactivity due to the hydrazine moiety, which can participate in various chemical reactions such as oxidation and condensation. The fluorine substituent on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its biological activity. As a hydrazine derivative, it may also exhibit some degree of toxicity and should be handled with care. The compound's applications could range from pharmaceutical development to research in organic synthesis, depending on its specific reactivity and interactions with other chemical entities. Overall, [1-(4-Fluorophenyl)propyl]hydrazine represents a unique structure that may have significant implications in medicinal chemistry and material science.
Formula:C9H13FN2
InChI:InChI=1S/C9H13FN2/c1-2-9(12-11)7-3-5-8(10)6-4-7/h3-6,9,12H,2,11H2,1H3
InChI key:InChIKey=HWSWJRNRTRBAME-UHFFFAOYSA-N
SMILES:C(CC)(NN)C1=CC=C(F)C=C1
Synonyms:- [1-(4-Fluorophenyl)propyl]hydrazine
- Hydrazine, [1-(4-fluorophenyl)propyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
