
CAS 1016780-77-0
:N-(3-Aminopropyl)cyclopropanecarboxamide
Description:
N-(3-Aminopropyl)cyclopropanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an amine functional group. This compound features a cyclopropanecarboxamide moiety, where the carboxamide group is attached to a cyclopropane ring, and an aminopropyl chain extending from the nitrogen atom. The presence of the amine group suggests potential for hydrogen bonding, influencing its solubility and reactivity. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular interactions can be significant in biological systems, potentially affecting receptor binding or enzyme activity. Additionally, the compound's stability and reactivity can be influenced by the steric and electronic effects of the cyclopropane and the aminopropyl group. Overall, N-(3-Aminopropyl)cyclopropanecarboxamide represents a class of compounds that may have diverse applications in pharmaceuticals and organic synthesis.
Formula:C7H14N2O
InChI:InChI=1S/C7H14N2O/c8-4-1-5-9-7(10)6-2-3-6/h6H,1-5,8H2,(H,9,10)
InChI key:InChIKey=NUDNUQOZWPHTRO-UHFFFAOYSA-N
SMILES:C(NCCCN)(=O)C1CC1
Synonyms:- N-(3-Aminopropyl)cyclopropanecarboxamide
- Cyclopropanecarboxamide, N-(3-aminopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.