CAS 10168-60-2
:4-Bromo-3-ethylpyridine
Description:
4-Bromo-3-ethylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and an ethyl group at the 3-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to the hydrophobic nature of the ethyl group. 4-Bromo-3-ethylpyridine can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in synthetic organic chemistry. Its bromine substituent can also serve as a leaving group in reactions, facilitating further functionalization. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Proper handling and storage are essential due to its potential toxicity and reactivity.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-2-6-5-9-4-3-7(6)8/h3-5H,2H2,1H3
InChI key:InChIKey=ZSFOQETZPKDUIQ-UHFFFAOYSA-N
SMILES:C(C)C=1C(Br)=CC=NC1
Synonyms:- 4-Bromo-3-ethylpyridine
- 4-broMo-3-ethylpyridine hydrobroMide
- Pyridine, 4-bromo-3-ethyl-
- 4-broMo-3-ethylpyridine h...
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
