CAS 101682-70-6

3-(4-Morpholinyl)-4-nitrobenzaldehyde

Description:

3-(4-Morpholinyl)-4-nitrobenzaldehyde is an organic compound characterized by its aromatic structure, which includes a nitro group and an aldehyde functional group. The presence of the morpholine ring contributes to its unique properties, enhancing its solubility in polar solvents and potentially influencing its reactivity. This compound typically appears as a yellow to orange solid and is known for its role in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. The nitro group is a strong electron-withdrawing group, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the morpholine moiety can participate in hydrogen bonding, which may influence the compound's physical properties, such as melting point and boiling point. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental hazards. Overall, 3-(4-Morpholinyl)-4-nitrobenzaldehyde is a versatile compound with significant applications in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₂N₂O₄

InChI: InChI=1S/C11H12N2O4/c14-8-9-1-2-10(13(15)16)11(7-9)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2

InChI key: InChIKey=FAJSCBIMFMOQMQ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(C=C(C=O)C=C1)N2CCOCC2

Synonyms:

• 3-(4-Morpholinyl)-4-nitrobenzaldehyde
• Benzaldehyde, 3-(4-morpholinyl)-4-nitro-