CymitQuimica logo

CAS 1016820-04-4

:

4-[(2,2,2-Trifluoroethoxy)methyl]piperidine

Description:
4-[(2,2,2-Trifluoroethoxy)methyl]piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,2,2-trifluoroethoxy group introduces significant polarity and influences the compound's solubility and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits properties typical of piperidine derivatives, such as basicity due to the nitrogen atom, which can participate in protonation reactions. The trifluoroethoxy moiety enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and drug design. Additionally, the trifluoromethyl groups can impart unique electronic properties, potentially influencing interactions with biological targets. Safety data should be consulted for handling, as fluorinated compounds can exhibit specific toxicity profiles. Overall, this compound's unique structure and functional groups make it a subject of interest in various chemical research fields.
Formula:C8H14F3NO
InChI:InChI=1S/C8H14F3NO/c9-8(10,11)6-13-5-7-1-3-12-4-2-7/h7,12H,1-6H2
InChI key:InChIKey=RALNDHPVNBOEST-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)C1CCNCC1
Synonyms:
  • Piperidine, 4-[(2,2,2-trifluoroethoxy)methyl]-
  • 4-[(2,2,2-Trifluoroethoxy)methyl]piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.