CAS 1016867-54-1

1-(2-Ethyl-1-oxobutyl)-4-piperidinone 4-oxime

Description:

1-(2-Ethyl-1-oxobutyl)-4-piperidinone 4-oxime, identified by its CAS number 1016867-54-1, is a chemical compound that features a piperidinone structure with an oxime functional group. This compound typically exhibits characteristics associated with both ketones and oximes, including potential reactivity due to the presence of the carbonyl and oxime functionalities. It may be a colorless to light yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethyl and butyl groups suggests moderate hydrophobicity, which may influence its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical or agrochemical research. Its synthesis and applications could involve various organic reactions, including condensation and reduction processes. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with exposure.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1S/C11H20N2O2/c1-3-9(4-2)11(14)13-7-5-10(12-15)6-8-13/h9,15H,3-8H2,1-2H3

InChI key: InChIKey=GTXCDUOIAGAAHO-UHFFFAOYSA-N

SMILES: C(C(CC)CC)(=O)N1CCC(=NO)CC1

Synonyms:

• 1-(2-Ethyl-1-oxobutyl)-4-piperidinone 4-oxime
• 4-Piperidinone, 1-(2-ethyl-1-oxobutyl)-, 4-oxime

2-Ethyl-1-[4-(hydroxyimino)piperidin-1-yl]butan-1-one

CAS: 1016867-54-1

Versatile small molecule scaffold

Formula: C₁₁H₂₀N₂O₂

Purity: Min. 95%

Molecular weight: 212.29 g/mol

Ref: 3D-RQB86754